A7830312
1-(Triphenylmethyl)imidazole , 98% , 15469-97-3
Synonym(s):
1-(Triphenylmethyl)imidazole
CAS NO.：15469-97-3
Empirical Formula: C22H18N2
Molecular Weight: 310.39
MDL number: MFCD00229427
EINECS: 628-022-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB56.00 | In Stock |
|
| 5G | RMB208.00 | In Stock |
|
| 25G | RMB666.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-224 °C(lit.) |
| Boiling point: | 451.3±14.0 °C(Predicted) |
| Density | 1.05±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly, Sonicated), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 6.34±0.30(Predicted) |
| color | White to Off-White |
| Water Solubility | Insoluble in water. |
| BRN | 238171 |
| InChI | InChI=1S/C22H18N2/c1-4-10-19(11-5-1)22(24-17-16-23-18-24,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-18H |
| InChIKey | NPZDCTUDQYGYQD-UHFFFAOYSA-N |
| SMILES | C1N(C(C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=CN=1 |
| CAS DataBase Reference | 15469-97-3(CAS DataBase Reference) |
Description and Uses
1-(Triphenylmethyl)imidazole may be used in the synthesis of 1,2,5-trisubstituted imidazole derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933299090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
