A7833612
2-(2-Thienyl)pyridine , 97% , 3319-99-1
CAS NO.：3319-99-1
Empirical Formula: C9H7NS
Molecular Weight: 161.22
MDL number: MFCD00044441
EINECS: 222-022-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB63.20 | In Stock |
|
| 5G | RMB219.20 | In Stock |
|
| 10g | RMB415.20 | In Stock |
|
| 25G | RMB942.40 | In Stock |
|
| 100g | RMB3079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61-63°C |
| Boiling point: | 140°C/16mmHg(lit.) |
| Density | 1.173±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.51±0.10(Predicted) |
| color | Light orange to Yellow to Green |
| BRN | 508454 |
| InChI | InChI=1S/C9H7NS/c1-2-6-10-8(4-1)9-5-3-7-11-9/h1-7H |
| InChIKey | QLPKTAFPRRIFQX-UHFFFAOYSA-N |
| SMILES | C1(C2SC=CC=2)=NC=CC=C1 |
| LogP | 2.702 (est) |
| CAS DataBase Reference | 3319-99-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
