A7834012
trans-4-(tert-butoxycarbonylamino)cyclohexanecarboxylic acid , 98% , 53292-89-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB159.20 | In Stock |
|
| 5G | RMB527.20 | In Stock |
|
| 25G | RMB1511.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181.0 to 185.0 °C |
| Boiling point: | 396.7±31.0 °C(Predicted) |
| Density | 1.12±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol (Slightly) |
| pka | 4.76±0.10(Predicted) |
| form | Powder |
| color | White |
| BRN | 7641071 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C12H21NO4/c1-12(2,3)17-11(16)13-9-6-4-8(5-7-9)10(14)15/h8-9H,4-7H2,1-3H3,(H,13,16)(H,14,15)/t8-,9- |
| InChIKey | KXMRDHPZQHAXML-KYZUINATSA-N |
| SMILES | [C@@H]1(C(O)=O)CC[C@@H](NC(OC(C)(C)C)=O)CC1 |
| CAS DataBase Reference | 53292-89-0(CAS DataBase Reference) |
Description and Uses
Trans-4-(Boc-amino)cyclohexanecarboxylic acid is a reagent to synthesize N-myristoyltransferase and CD38 inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 13 - Non Combustible Solids |







