BD8187931
trans-4-((2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)methyl)cyclohexanecarboxylic acid , 97% , 69907-67-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB26.40 | In Stock |
|
| 250mg | RMB40.00 | In Stock |
|
| 1g | RMB79.20 | In Stock |
|
| 5g | RMB295.20 | In Stock |
|
| 10g | RMB562.40 | In Stock |
|
| 25g | RMB1268.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 144 °C(Solv: benzene (71-43-2)) |
| Boiling point: | 433.6±18.0 °C(Predicted) |
| Density | 1.329 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.80±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C12H15NO4/c14-10-5-6-11(15)13(10)7-8-1-3-9(4-2-8)12(16)17/h5-6,8-9H,1-4,7H2,(H,16,17)/t8-,9- |
| InChIKey | LQILVUYCDHSGEU-KYZUINATSA-N |
| SMILES | [C@@H]1(C(O)=O)CC[C@@H](CN2C(=O)C=CC2=O)CC1 |
| CAS DataBase Reference | 69907-67-1 |
Description and Uses
Trans-4-(Maleimidomethyl) cyclohexanecarboxylic Acid is a kind of carboxylate, being well known for its N-hydroxysuccinimide ester derivative (SMCC), which is a useful cross-linking reagent. SMCC is widely used for the generation of stable maleimide-activated carrier proteins, enzyme immunoconjugates and hapten carrier molecule conjugates. It can be used for the coupling of a peptide to an amino group.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2928009090 |
