A7839512
3-(2-Thienyl)-L-alanine , 95% , 22951-96-8
Synonym(s):
(S)-α-Amino-2-thiophenepropionic acid;(S)-2-Amino-3-(2-thienyl)propionic acid
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB74.40 | In Stock |
|
| 1G | RMB167.20 | In Stock |
|
| 5G | RMB623.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 255-263 °C (dec.) (lit.)
~260 °C (dec.) |
| alpha | -31.5 º (C=1% IN H2O) |
| Boiling point: | 315.9±32.0 °C(Predicted) |
| Density | 1.349±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| pka | 2.15±0.10(Predicted) |
| form | Solid |
| color | Off-white |
| optical activity | [α]20/D 30.5±1.5°, c = 1% in H2O |
| Water Solubility | Slightly soluble in water. |
| BRN | 82872 |
| Major Application | peptide synthesis |
| InChI | InChI=1/C7H9NO2S/c8-6(7(9)10)4-5-2-1-3-11-5/h1-3,6H,4,8H2,(H,9,10)/t6-/s3 |
| InChIKey | WTOFYLAWDLQMBZ-LURJTMIESA-N |
| SMILES | C(C1SC=CC=1)[C@H](N)C(=O)O |&1:6,r| |
| CAS DataBase Reference | 22951-96-8(CAS DataBase Reference) |
Description and Uses
3-(2-Thienyl)-L-alanine can be used in agrochemical, pharmaceutical and dyestuff field.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







