A7841212
Tocainide , 99% , 59-26-7
Synonym(s):
‘Nikethamide’;N,N-Diethylnicotinamide;DENC;Nicotinic acid diethylamide
CAS NO.：59-26-7
Empirical Formula: C10H14N2O
Molecular Weight: 178.23
MDL number: MFCD00006386
EINECS: 200-418-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB48.80 | In Stock |
|
| 25g | RMB84.80 | In Stock |
|
| 100g | RMB234.40 | In Stock |
|
| 500G | RMB934.40 | In Stock |
|
| 2.5kg | RMB3735.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 23 °C (lit.) |
| Boiling point: | 296-300 °C (lit.) |
| Density | 1.06 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| pka | pKa 3.46(H2O,t =20) (Uncertain) |
| form | Liquid |
| color | Clear colorless to yellow |
| Merck | 14,6543 |
| BRN | 5743 |
| InChI | InChI=1S/C10H14N2O/c1-3-12(4-2)10(13)9-6-5-7-11-8-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | NCYVXEGFNDZQCU-UHFFFAOYSA-N |
| SMILES | C1=NC=CC=C1C(N(CC)CC)=O |
| CAS DataBase Reference | 59-26-7(CAS DataBase Reference) |
| EPA Substance Registry System | Nikethamide (59-26-7) |
Description and Uses
A further Corydalis alkaloid, coramine has been obtained from C. pseudoadunca M. Pop. It forms colourless needles from EtOH and is optically active with a specific rotation of [α]D - 391 ° (c 0.2, MeOH). Both the hydrochloride, m.p. 216-9°C and the hydrobromide, m.p. 223-6°C have been described.
analeptic
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H319 |
| Precautionary statements | P264-P270-P280-P301+P310-P305+P351+P338-P337+P313 |
| Hazard Codes | T |
| Risk Statements | 25-36/37/38-23/24/25 |
| Safety Statements | 26-45-36/37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | QS4375000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29333999 |
| Toxicity | LD50 i.p. in rats: 272 mg/kg (Goldenthal) |
