A7841212
                    Tocainide , 99% , 59-26-7
                            Synonym(s):
‘Nikethamide’;N,N-Diethylnicotinamide;DENC;Nicotinic acid diethylamide
                            
                        
                CAS NO.:59-26-7
Empirical Formula: C10H14N2O
Molecular Weight: 178.23
MDL number: MFCD00006386
EINECS: 200-418-5
| Pack Size | Price | Stock | Quantity | 
| 5g | RMB48.80 | In Stock | 
                                                 | 
                                        
| 25g | RMB84.80 | In Stock | 
                                                 | 
                                        
| 100g | RMB234.40 | In Stock | 
                                                 | 
                                        
| 500G | RMB934.40 | In Stock | 
                                                 | 
                                        
| 2.5kg | RMB3735.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 23 °C (lit.) | 
                                    
| Boiling point: | 296-300 °C (lit.) | 
                                    
| Density | 1.06 g/mL at 25 °C (lit.) | 
                                    
| refractive index | n | 
                                    
| Flash point: | >230 °F | 
                                    
| storage temp. | 2-8°C | 
                                    
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | 
                                    
| pka | pKa 3.46(H2O,t =20) (Uncertain) | 
                                    
| form | Liquid | 
                                    
| color | Clear colorless to yellow | 
                                    
| Merck | 14,6543 | 
                                    
| BRN | 5743 | 
                                    
| InChI | InChI=1S/C10H14N2O/c1-3-12(4-2)10(13)9-6-5-7-11-8-9/h5-8H,3-4H2,1-2H3 | 
                                    
| InChIKey | NCYVXEGFNDZQCU-UHFFFAOYSA-N | 
                                    
| SMILES | C1=NC=CC=C1C(N(CC)CC)=O | 
                                    
| CAS DataBase Reference | 59-26-7(CAS DataBase Reference) | 
                                    
| EPA Substance Registry System | Nikethamide (59-26-7) | 
                                    
Description and Uses
A further Corydalis alkaloid, coramine has been obtained from C. pseudoadunca M. Pop. It forms colourless needles from EtOH and is optically active with a specific rotation of [α]D - 391 ° (c 0.2, MeOH). Both the hydrochloride, m.p. 216-9°C and the hydrobromide, m.p. 223-6°C have been described.
analeptic
Safety
| Symbol(GHS) | ![]() GHS06  | 
                                    
| Signal word | Danger | 
| Hazard statements | H301-H319 | 
| Precautionary statements | P264-P270-P280-P301+P310-P305+P351+P338-P337+P313 | 
| Hazard Codes | T | 
| Risk Statements | 25-36/37/38-23/24/25 | 
| Safety Statements | 26-45-36/37/39 | 
| RIDADR | UN 2811 6.1/PG 3 | 
| WGK Germany | 3 | 
| RTECS | QS4375000 | 
| HazardClass | 6.1(b) | 
| PackingGroup | III | 
| HS Code | 29333999 | 
| Toxicity | LD50 i.p. in rats: 272 mg/kg (Goldenthal) | 





