A7842812
2,4,6-Tribromotoluene , 98% , 6320-40-7
CAS NO.：6320-40-7
Empirical Formula: C7H5Br3
Molecular Weight: 328.83
MDL number: MFCD00013527
EINECS: 228-672-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.00 | In Stock |
|
| 5g | RMB113.60 | In Stock |
|
| 10G | RMB216.80 | In Stock |
|
| 25g | RMB442.40 | In Stock |
|
| 50G | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68-71 °C(lit.) |
| Boiling point: | 290°C |
| Density | 2,479 g/cm3 |
| refractive index | 1.6340 (estimate) |
| Flash point: | 290°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Powder and/or Chunks |
| color | Yellow to light brown |
| Water Solubility | Insoluble in water. |
| BRN | 2359313 |
| InChI | InChI=1S/C7H5Br3/c1-4-6(9)2-5(8)3-7(4)10/h2-3H,1H3 |
| InChIKey | BFRIZWKDNUHPHL-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(Br)=CC(Br)=C1C |
| CAS DataBase Reference | 6320-40-7(CAS DataBase Reference) |
Description and Uses
2,4,6-Tribromotoluene acts as a reagent in the synthesis of non-proteinogenic α-amino acids.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29039990 |
