A7847212
5-Trifluoromethyl-pyridine-2-carboxylic acid methyl ester , 97% , 124236-37-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB171.20 | In Stock |
|
| 5g | RMB499.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 248.0±40.0 °C(Predicted) |
| Density | 1.331±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | solid |
| pka | -0.73±0.10(Predicted) |
| Appearance | Off-white to light brown Solid |
| InChI | InChI=1S/C8H6F3NO2/c1-14-7(13)6-3-2-5(4-12-6)8(9,10)11/h2-4H,1H3 |
| InChIKey | CHRQADSGOKVKER-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=NC=C(C(F)(F)F)C=C1 |
Description and Uses
5-Trifluoromethyl-pyridine-2-carboxylic acid methyl ester is a pharmaceutical intermediate for naphthoquinone derivatives used in the treatment of oxidative stress disorders, modulators of cystic fibrosis transmembrane conductance modulators.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |







