A7847912
2-(Tributylstannyl)pyridine , ≥85% , 17997-47-6
CAS NO.:17997-47-6
Empirical Formula: C17H31NSn
Molecular Weight: 368.14
MDL number: MFCD00052052
EINECS: 628-762-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB135.20 | In Stock |
|
| 25G | RMB560.00 | In Stock |
|
| 100g | RMB2073.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-135 °C |
| Boiling point: | 134 °C |
| Density | 1.15 |
| refractive index | 1.5130 |
| Flash point: | >110°C |
| storage temp. | -20°C |
| pka | 5.21±0.19(Predicted) |
| form | liquid |
| Specific Gravity | 1.142 |
| color | Clear, yellow |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 479329 |
| Exposure limits | ACGIH: TWA 0.1 mg/m3; STEL 0.2 mg/m3 (Skin) NIOSH: IDLH 25 mg/m3; TWA 0.1 mg/m3 |
| InChI | 1S/C5H4N.3C4H9.Sn/c1-2-4-6-5-3-1;3*1-3-4-2;/h1-4H;3*1,3-4H2,2H3; |
| InChIKey | GYUURHMITDQTRU-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccccn1 |
| CAS DataBase Reference | 17997-47-6(CAS DataBase Reference) |
Description and Uses
Building block in an efficient, palladium-catalyzed synthesis of 2-pyridylazaazulene, a bidentate ligand showing pH and cationic-metal dependent emission spectra.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H226-H301-H312-H315-H319-H360FD-H372-H410 |
| Precautionary statements | P210-P273-P280-P301+P310-P303+P361+P353-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,Xi,N |
| Risk Statements | 21-25-36/38-48/23/25-50/53-10 |
| Safety Statements | 35-36/37/39-45-61-60 |
| RIDADR | 2788 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| TSCA | No |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Flam. Liq. 3 Repr. 1B Skin Irrit. 2 STOT RE 1 |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |









