Glyceryltriacetate , 10mMinDMSO , 102-76-1
Synonym(s):
1,2,3-Triacetoxypropane;1,2,3-Triacetylglycerol;Glycerol triacetate;Glyceryl triacetate;Triacetin
CAS NO.:102-76-1
Empirical Formula: C9H14O6
Molecular Weight: 218.2
MDL number: MFCD00008716
EINECS: 203-051-9
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 3 °C(lit.) |
| Boiling point: | 258-260 °C(lit.) |
| Density | 1.16 g/mL at 25 °C(lit.) |
| vapor density | 7.52 (vs air) |
| vapor pressure | 0.00248 mm Hg @ 250C |
| refractive index | n |
| FEMA | 2007 | (TRI-)ACETIN |
| Flash point: | 300 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in water, miscible with ethanol (96 per cent) and toluene. |
| form | Liquid |
| color | Clear colorless |
| Odor | Characteristic odour |
| PH | 5.0-6.0 (20°C, 50g/L in H2O) |
| Odor Type | fruity |
| biological source | synthetic |
| explosive limit | 1.05%, 189°F |
| Water Solubility | 64.0 g/L (20 ºC) |
| Merck | 14,9589 |
| JECFA Number | 920 |
| BRN | 1792353 |
| Dielectric constant | 7.2(20℃) |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PLASTICISER SOLVENT FILM FORMING FRAGRANCE ANTIMICROBIAL |
| InChI | 1S/C9H14O6/c1-6(10)13-4-9(15-8(3)12)5-14-7(2)11/h9H,4-5H2,1-3H3 |
| InChIKey | URAYPUMNDPQOKB-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(COC(C)=O)OC(C)=O |
| LogP | 0.25 |
| CAS DataBase Reference | 102-76-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2,3-Propanetriol, triacetate(102-76-1) |
| EPA Substance Registry System | Glyceryl triacetate (102-76-1) |
Description and Uses
§ 184.1901(a) Triacetin (C8H14O6), also known as 1,2,3-propanetriol triacetate or glyceryl triacetate, is the triester of glycerin and acetic acid. Triacetin can be prepared by heating glycerin with acetic anhydride alone or in the presence of finely divided potassium hydrogen sulfate. It can also be prepared by the reaction of oxygen with a liquid-phase mixture of allyl acetate and acetic acid using a bromide salt as a catalyst.
Triacetin is a colorless, oily liquid of slight fatty odor and bitter taste. It is soluble with water and is miscible with alcohol and ether. It functions in foods as a humectant and solvent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H303 |
| Precautionary statements | P270-P301+P312-P403-P501c |
| Safety Statements | 23-24/25 |
| WGK Germany | 1 |
| RTECS | AK3675000 |
| Autoignition Temperature | 809 °F |
| TSCA | TSCA listed |
| HS Code | 29153930 |
| Storage Class | 10 - Combustible liquids |
| Hazardous Substances Data | 102-76-1(Hazardous Substances Data) |
| Toxicity | LD50 i.v. in mice: 1600 ±81 mg/kg (Wretlind) |






