A7848712
Tofisopam , ≥98% , 22345-47-7
Synonym(s):
7,8-Dimethoxy-1-(3,4-dimethoxyphenyl)-5-ethyl-4-methyl-5H-2,3-benzodiazepine;EGYT 341;Seriel
CAS NO.:22345-47-7
Empirical Formula: C22H26N2O4
Molecular Weight: 382.45
MDL number: MFCD00823171
EINECS: 244-922-3
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB119.20 | In Stock |
|
| 250mg | RMB224.80 | In Stock |
|
| 1G | RMB435.20 | In Stock |
|
| 5g | RMB4597.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-159°C |
| Boiling point: | 509.61°C (rough estimate) |
| Density | 1.2098 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| solubility | DMSO: ~14 mg/mL |
| pka | 7.29±0.40(Predicted) |
| form | solid |
| color | white |
| λmax | 310nm(MeOH)(lit.) |
| Merck | 14,9503 |
| Stability: | Hygroscopic |
| InChI | 1S/C22H26N2O4/c1-7-15-13(2)23-24-22(14-8-9-18(25-3)19(10-14)26-4)17-12-21(28-6)20(27-5)11-16(15)17/h8-12,15H,7H2,1-6H3 |
| InChIKey | RUJBDQSFYCKFAA-UHFFFAOYSA-N |
| SMILES | CCC1C(C)=NN=C(c2ccc(OC)c(OC)c2)c3cc(OC)c(OC)cc13 |
Description and Uses
Tofisopam is a reagent used in preparation of allosteric ligands for pharmacological dark receptors GPR68 and GPR65. An anticonvulsant.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H400 |
| Precautionary statements | P273-P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | DE9540000 |
| HS Code | 2933.99.8290 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 |




![3-[2-(3,4-dimethoxybenzoyl)-4,5-dimethoxyphenyl]pentan-2-one](https://img.chemicalbook.com/CAS/GIF/15462-91-6.gif)

