A7849912
2,3,4,5-Tetramethyl-2-cyclopentenone , ≥95%, a mixture , 54458-61-6
CAS NO.:54458-61-6
Empirical Formula: C9H14O
Molecular Weight: 138.21
MDL number: MFCD00010248
EINECS: 611-148-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB62.40 | In Stock |
|
| 25G | RMB236.80 | In Stock |
|
| 100g | RMB799.20 | In Stock |
|
| 500g | RMB3575.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 100 °C30 mm Hg(lit.) |
| Density | 0.927 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 164 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| form | Oil |
| color | Clear Colourless |
| Specific Gravity | 0.917 |
| Water Solubility | Not miscible with water. |
| BRN | 2324088 |
| InChI | InChI=1S/C9H14O/c1-5-6(2)8(4)9(10)7(5)3/h5,7H,1-4H3 |
| InChIKey | ARUAYSANQMCCEN-UHFFFAOYSA-N |
| SMILES | C1(=O)C(C)C(C)C(C)=C1C |
| CAS DataBase Reference | 54458-61-6(CAS DataBase Reference) |
Description and Uses
2,3,4,5-Tetramethyl-2-cyclopentenone can be used as organic synthesis intermediates and pharmaceutical intermediates, mainly used in laboratory research and development processes and chemical production processes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Safety Statements | 23-24/25-35-3/9/49-43-36-15 |
| WGK Germany | 3 |
| HS Code | 29142990 |
| Storage Class | 10 - Combustible liquids |




