A7851412
1-(tert-Butoxycarbonyl)-2-pyrrolidinone , ≥95% , 85909-08-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB31.20 | In Stock |
|
| 25G | RMB52.00 | In Stock |
|
| 100g | RMB156.80 | In Stock |
|
| 500g | RMB760.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 100-105 °C/0.5 mmHg(lit.) |
| Density | 1.086 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.466(lit.) |
| Flash point: | 113 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| pka | -2.21±0.20(Predicted) |
| form | Oil |
| color | Clear Colorless to Brown |
| InChI | InChI=1S/C9H15NO3/c1-9(2,3)13-8(12)10-6-4-5-7(10)11/h4-6H2,1-3H3 |
| InChIKey | GJJYYMXBCYYXPQ-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCCC1=O |
Description and Uses
N-Boc-2-pyrrolidinone is a useful synthetic intermediate. It can be used to prepare highly functionalized N-acyl-2-vinylpyrrolidines by a 4-component Ugi reaction (isocyanide, carbonyl compounds, primary amines, carboxylic acids). It can also be used to synthesize the naturally occurring Maillard flavors via catalytic SeO2 oxidation.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933790090 |
