PRODUCT Properties
| Melting point: | 63-64°C |
| Boiling point: | 144-145°C 10mm |
| Density | 1.00±0.1 g/cm3(Predicted) |
| Flash point: | 144-145°C/10mm |
| storage temp. | RT, stored under nitrogen |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Orange to Green |
| Sensitive | Moisture Sensitive |
| BRN | 2690815 |
| InChI | InChI=1S/C10H11NS/c1-7-4-8(2)10(11-6-12)9(3)5-7/h4-5H,1-3H3 |
| InChIKey | KKYMYPLVBCVDPL-UHFFFAOYSA-N |
| SMILES | C1(C)=CC(C)=CC(C)=C1N=C=S |
| CAS DataBase Reference | 6095-82-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H312-H314-H318-H331 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | T |
| Risk Statements | 20/21/22-36/37/38-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 2811 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29420000 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
