A7862112
<i>trans</i>-4-Hydroxycyclohexanecarboxylic Acid , >97.0%(GC) , 3685-26-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB30.40 | In Stock |
|
| 1g | RMB68.80 | In Stock |
|
| 5G | RMB278.40 | In Stock |
|
| 10g | RMB450.40 | In Stock |
|
| 25G | RMB912.80 | In Stock |
|
| 100g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145°C |
| Boiling point: | 308℃ |
| Density | 1.246 |
| Flash point: | 154℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| pka | pK1:4.687 (25°C) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C7H12O3/c8-6-3-1-5(2-4-6)7(9)10/h5-6,8H,1-4H2,(H,9,10)/t5-,6- |
| InChIKey | HCFRWBBJISAZNK-IZLXSQMJSA-N |
| SMILES | [C@@H]1(C(O)=O)CC[C@@H](O)CC1 |
Description and Uses
trans-4-Hydroxycyclohexylcarboxylic Acid acts as a reagent in the synthetic preparation of pyrazole-pyrimidine preparation as TTK inhibitors and potential antitumors, Preparation and Janus kinase 1 (JAK1)-selective inhibitory activity of benzimidazole derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2916200090 |







