A7870212
4-(Trifluoromethoxy)benzaldehyde , >97.0%(GC) , 659-28-9
Synonym(s):
α,α,α-Trifluoroanisaldehyde
CAS NO.：659-28-9
Empirical Formula: C8H5F3O2
Molecular Weight: 190.12
MDL number: MFCD00041530
EINECS: 211-531-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB116.80 | In Stock |
|
| 100g | RMB436.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 93 °C27 mm Hg(lit.) |
| Density | 1.331 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 159 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | Liquid |
| color | Clear colorless to pale yellow-green |
| Specific Gravity | 1.331 |
| Sensitive | Air Sensitive |
| BRN | 1949135 |
| InChI | InChI=1S/C8H5F3O2/c9-8(10,11)13-7-3-1-6(5-12)2-4-7/h1-5H |
| InChIKey | XQNVDQZWOBPLQZ-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(OC(F)(F)F)C=C1 |
| CAS DataBase Reference | 659-28-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzaldehyde, 4-(trifluoromethoxy)-(659-28-9) |
Description and Uses
4-(Trifluoromethoxy)benzaldehyde is suitable for use in the synthesis of (E)-4-(trifluoromethoxy)benzaldehyde thiosemicarbazone. It may be used in the synthesis of:
- new azo dyes containing of 5(4H)-oxazolone ring
- 2-[4-(trifluoromethoxy)phenyl]-1H-benzimidazole
- (E)-2-[4-(trifluoromethoxy)benzylidene]indan-1-one.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H227 |
| Precautionary statements | P210e-P280a-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36/38-22 |
| Safety Statements | 26-36/37/39-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29130000 |
