A7740912
4-(Trifluoromethoxy)benzoic acid , 97% , 330-12-1
CAS NO.：330-12-1
Empirical Formula: C8H5F3O3
Molecular Weight: 206.12
MDL number: MFCD00002541
EINECS: 206-352-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.00 | In Stock |
|
| 5G | RMB55.20 | In Stock |
|
| 25G | RMB247.20 | In Stock |
|
| 100g | RMB879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-154 °C(lit.) |
| Boiling point: | 203°C (rough estimate) |
| Density | 1.4251 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| pka | 3.85±0.10(Predicted) |
| form | Powder |
| color | White to cream |
| BRN | 977356 |
| InChI | InChI=1S/C8H5F3O3/c9-8(10,11)14-6-3-1-5(2-4-6)7(12)13/h1-4H,(H,12,13) |
| InChIKey | RATSANVPHHXDCT-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(OC(F)(F)F)C=C1 |
| CAS DataBase Reference | 330-12-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-(Trifluoromethoxy)benzoic acid(330-12-1) |
Description and Uses
4-(Trifluoromethoxy)benzoic Acid is a substituted benzoic acid used in the preparation of a various biologically active compounds such as antifungal and antimalarial agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
