BD1799548
1-(Chloromethyl)-4-(trifluoromethoxy)benzene , 98% , 65796-00-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB28.80 | In Stock |
|
| 25g | RMB113.60 | In Stock |
|
| 100g | RMB428.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 72 °C |
| Density | 1.34 |
| refractive index | 1.4520-1.4560 |
| storage temp. | Refrigerator |
| form | clear liquid |
| color | Colorless to Almost colorless |
| InChI | 1S/C8H6ClF3O/c9-5-6-1-3-7(4-2-6)13-8(10,11)12/h1-4H,5H2 |
| InChIKey | LBMKFQMJURUPKC-UHFFFAOYSA-N |
| SMILES | ClCC1=CC=C(OC(F)(F)F)C=C1 |
| CAS DataBase Reference | 65796-00-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H227-H290-H314-H318 |
| Precautionary statements | P305+P351+P338-P309-P310-P210-P234-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P403+P235-P405-P406-P501 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 1760 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2909309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







