A7741312
4-(Trifluoromethyl)phenylacetic acid , 99% , 32857-62-8
Synonym(s):
(α,α,α-Trifluoro-p-tolyl)acetic acid
CAS NO.:32857-62-8
Empirical Formula: C9H7F3O2
Molecular Weight: 204.15
MDL number: MFCD00004352
EINECS: 251-263-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB38.40 | In Stock |
|
| 5G | RMB84.80 | In Stock |
|
| 25G | RMB336.00 | In Stock |
|
| 100G | RMB869.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82-85 °C(lit.) |
| Boiling point: | 203°C (rough estimate) |
| Density | 1.2815 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.01±0.10(Predicted) |
| form | Crystals or Crystalline Powder |
| color | White to very pale yellow |
| BRN | 2267687 |
| InChI | 1S/C9H7F3O2/c10-9(11,12)7-3-1-6(2-4-7)5-8(13)14/h1-4H,5H2,(H,13,14) |
| InChIKey | HNORVZDAANCHAY-UHFFFAOYSA-N |
| SMILES | OC(=O)Cc1ccc(cc1)C(F)(F)F |
| CAS DataBase Reference | 32857-62-8(CAS DataBase Reference) |
| NIST Chemistry Reference | («ALPHA»,«alpha»,«alpha»-trifluoro-p-tolyl)-acetic acid(32857-62-8) |
Description and Uses
4-(Trifluoromethyl)benzeneacetic Acid is an intermediate used to synthesize PPARγ/δ dual agonists via solid-Phase parallel synthesis. It was also used to prepare heterocyclic xanthine derivatives as highly potent and selective human A2B adenosine receptor antagonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







