A7893012
<i>trans</i>-2-Hexenyl Butyrate , >93.0%(GC) , 53398-83-7
CAS NO.:53398-83-7
Empirical Formula: C10H18O2
Molecular Weight: 170.25
MDL number: MFCD00036546
EINECS: 258-515-3
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB47.20 | In Stock |
|
| 5ML | RMB127.20 | In Stock |
|
| 25ML | RMB330.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 190 °C(lit.) |
| Density | 0.885 g/mL at 25 °C(lit.) |
| FEMA | 3926 | TRANS-2-HEXENYL BUTYRATE |
| refractive index | n |
| Flash point: | 186 °F |
| solubility | Insoluble in water, soluble in alcohol and oils. |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Odor | at 100.00 %. green fruity apricot ripe banana cortex orchid fermented |
| Odor Type | green |
| biological source | synthetic |
| JECFA Number | 1375 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C10H18O2/c1-3-5-6-7-9-12-10(11)8-4-2/h6-7H,3-5,8-9H2,1-2H3/b7-6+ |
| InChIKey | PCGACKLJNBBQGM-VOTSOKGWSA-N |
| SMILES | [H]\C(CCC)=C(\[H])COC(=O)CCC |
| LogP | 3.64 |
| CAS DataBase Reference | 53398-83-7(CAS DataBase Reference) |
| EPA Substance Registry System | (E)-2-Hexenyl butyrate (53398-83-7) |
Description and Uses
trans-2-Hexenyl butyrate is a sex pheromone.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| HS Code | 29156000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






