A7893512
1,3,5-Tris(4-aminophenyl)benzene , >93.0%(HPLC) , 118727-34-7
CAS NO.：118727-34-7
Empirical Formula: C24H21N3
Molecular Weight: 351.44
MDL number: MFCD18207723
EINECS: 209-383-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB96.80 | In Stock |
|
| 1G | RMB177.60 | In Stock |
|
| 5G | RMB875.20 | In Stock |
|
| 25g | RMB3988.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >200℃ (ethanol ) |
| Boiling point: | 576.3±45.0 °C(Predicted) |
| Density | 1.203±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Acetonitrile (Slightly), DMSO (Slightly, Heated) |
| form | Solid |
| pka | 4.94±0.10(Predicted) |
| color | Pale Orange to Orange |
| InChI | InChI=1S/C24H21N3/c25-22-7-1-16(2-8-22)19-13-20(17-3-9-23(26)10-4-17)15-21(14-19)18-5-11-24(27)12-6-18/h1-15H,25-27H2 |
| InChIKey | QHQSCKLPDVSEBJ-UHFFFAOYSA-N |
| SMILES | C1(C2=CC(C3=CC=C(N)C=C3)=CC(C3=CC=C(N)C=C3)=C2)=CC=C(N)C=C1 |
Description and Uses
1,3,5-Tris(4-aminophenyl)benzene (cas# 118727-34-7) is a useful reagent for catalytic asymmetric synthesis of chiral covalent compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| HS Code | 29225090 |
