A7894812
2,3,5,6-Tetrafluoro-4-aminobenzotrifluoride , >97.0%(GC) , 651-83-2
Synonym(s):
2,3,5,6,α,α,α-Heptafluoro-p-toluidine;2,3,5,6-Tetrafluoro-4-(trifluoromethyl)aniline
| Pack Size | Price | Stock | Quantity |
| 1G | RMB239.20 | In Stock |
|
| 5G | RMB687.20 | In Stock |
|
| 25g | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 186 °C(lit.) |
| Density | 1.687 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 190 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | clear liquid |
| pka | -2.05±0.10(Predicted) |
| Specific Gravity | 1.680 |
| color | Colorless to Light yellow to Light orange |
| BRN | 2657893 |
| InChI | 1S/C7H2F7N/c8-2-1(7(12,13)14)3(9)5(11)6(15)4(2)10/h15H2 |
| InChIKey | FJOACTZFMHZHSC-UHFFFAOYSA-N |
| SMILES | Nc1c(F)c(F)c(c(F)c1F)C(F)(F)F |
| CAS DataBase Reference | 651-83-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29214300 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






