A7899312
2,4,5-Trimethylbenzoic Acid , 97% , 528-90-5
CAS NO.：528-90-5
Empirical Formula: C10H12O2
Molecular Weight: 164.2
MDL number: MFCD00075863
EINECS: 200-002-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB98.24 | In Stock |
|
| 5G | RMB336.00 | In Stock |
|
| 10g | RMB597.44 | In Stock |
|
| 25G | RMB1190.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-153 °C (lit.) |
| Boiling point: | 288.61°C (estimate) |
| Density | 1.0670 (estimate) |
| refractive index | 1.5198 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 4.24±0.25(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C10H12O2/c1-6-4-8(3)9(10(11)12)5-7(6)2/h4-5H,1-3H3,(H,11,12) |
| InChIKey | QENJZWZWAWWESF-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(C)=C(C)C=C1C |
| CAS DataBase Reference | 528-90-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 2,4,5-trimethyl-(528-90-5) |
| EPA Substance Registry System | 2,4,5-Trimethylbenzoic acid (528-90-5) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | DI0887000 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
