A7900212
Trimethyl(phenoxy)silane , >97.0%(GC) , 1529-17-5
Synonym(s):
Phenoxy(trimethyl)silane;Phenyl trimethylsilyl ether
CAS NO.:1529-17-5
Empirical Formula: C9H14OSi
Molecular Weight: 166.29
MDL number: MFCD00053666
EINECS: 216-211-8
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB183.20 | In Stock |
|
| 25ML | RMB639.20 | In Stock |
|
| 100ML | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -55 °C |
| Boiling point: | 81 °C23 mm Hg(lit.) |
| Density | 0.92 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 127 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 0.92 |
| λmax | 274nm(Heptane)(lit.) |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 1905943 |
| InChI | InChI=1S/C9H14OSi/c1-11(2,3)10-9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | OJAJJFGMKAZGRZ-UHFFFAOYSA-N |
| SMILES | C1(O[Si](C)(C)C)=CC=CC=C1 |
| EPA Substance Registry System | Silane, trimethylphenoxy- (1529-17-5) |
Description and Uses
Trimethyl(phenoxy)silane can be used as a catalyst for the Friedel-Crafts reaction, which is an organic reaction that converts alkenes into alcohols or epoxides. It can also reacts with hydrochloric acid to give phenol and chloroform. Trimethyl(phenoxy)silane has been shown to have chemical properties similar to those of phenol, such as viscosity, chemical species and resonance spectroscopy properties. It can react with oxygen in the air to form peroxides, so it should be stored in a cool, dry place away from light.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







