A7901312
Tetramethyl-1,4-benzoquinone , >98.0%(GC) , 527-17-3
Synonym(s):
2,3,5,6-Tetramethyl-1,4-benzoquinone;Tetramethyl-p-benzoquinone
CAS NO.:527-17-3
Empirical Formula: C10H12O2
Molecular Weight: 164.2
MDL number: MFCD00001604
EINECS: 208-409-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB153.60 | In Stock |
|
| 5G | RMB492.80 | In Stock |
|
| 25G | RMB1933.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-112 °C(lit.) |
| Boiling point: | 251.67°C (rough estimate) |
| Density | 1.0326 (rough estimate) |
| refractive index | 1.5220 (estimate) |
| storage temp. | under inert gas (Argon) |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| Merck | 14,3470 |
| BRN | 1909128 |
| InChI | InChI=1S/C10H12O2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h1-4H3 |
| InChIKey | WAMKWBHYPYBEJY-UHFFFAOYSA-N |
| SMILES | C1(=O)C(C)=C(C)C(=O)C(C)=C1C |
| CAS DataBase Reference | 527-17-3(CAS DataBase Reference) |
Description and Uses
Tetramethyl-1,4-benzoquinone is an antioxidant.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | GU5410000 |
| HS Code | 29146990 |
| Storage Class | 11 - Combustible Solids |






