A7902812
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenol , ≥97%(GC) , 269409-70-3
Synonym(s):
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;4-Hydroxyphenylboronic acid pinacol cyclic ester
CAS NO.:269409-70-3
Empirical Formula: C12H17BO3
Molecular Weight: 220.07
MDL number: MFCD02093756
EINECS: 627-688-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB56.00 | In Stock |
|
| 5G | RMB94.40 | In Stock |
|
| 25G | RMB239.20 | In Stock |
|
| 100G | RMB799.20 | In Stock |
|
| 500g | RMB3439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-117 °C (lit.) |
| Boiling point: | 333.8±25.0 °C(Predicted) |
| Density | 1.08±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Acetonitrile, DMSO, Methanol |
| form | Crystalline Powder |
| pka | 9.61±0.30(Predicted) |
| color | Yellow to light brown |
| Water Solubility | Insoluble |
| InChI | InChI=1S/C12H17BO3/c1-11(2)12(3,4)16-13(15-11)9-5-7-10(14)8-6-9/h5-8,14H,1-4H3 |
| InChIKey | BICZJRAGTCRORZ-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(B2OC(C)(C)C(C)(C)O2)C=C1 |
| CAS DataBase Reference | 269409-70-3(CAS DataBase Reference) |
Description and Uses
4-Hydroxyphenylboronic acid pinacol ester is widely used in Suzuki coupling chemistry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| REACH Registrations | Active |





