A7904612
1,2,3-Trifluorobenzene , >98.0%(GC) , 1489-53-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB52.00 | In Stock |
|
| 5G | RMB123.20 | In Stock |
|
| 25G | RMB286.40 | In Stock |
|
| 100g | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 94-95 °C (lit.) |
| Density | 1.28 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 25 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.280 |
| BRN | 1862388 |
| Stability: | Stable. Highly flammable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C6H3F3/c7-4-2-1-3-5(8)6(4)9/h1-3H |
| InChIKey | AJKNNUJQFALRIK-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(F)=C1F |
| CAS DataBase Reference | 1489-53-8(CAS DataBase Reference) |
Description and Uses
1,2, 3-trifluorobenzene is an organic fluorine compound, mainly used as an intermediate in the production of drugs, agricultural chemicals and dyes.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36/37/39-37/39-33-7/9 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





