A7906012
5-<i>tert</i>-Butylisophthalic Acid , 98% , 2359-09-3
CAS NO.:2359-09-3
Empirical Formula: C12H14O4
Molecular Weight: 222.24
MDL number: MFCD00067047
EINECS: 219-100-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB71.20 | In Stock |
|
| 25G | RMB239.20 | In Stock |
|
| 100g | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Boiling point: | 400.0±42.0 °C(Predicted) |
| Density | 1.226±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.63±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C12H14O4/c1-12(2,3)9-5-7(10(13)14)4-8(6-9)11(15)16/h4-6H,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | BJLUCDZIWWSFIB-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=CC(C(C)(C)C)=CC(C(O)=O)=C1 |
| CAS DataBase Reference | 2359-09-3(CAS DataBase Reference) |
| EPA Substance Registry System | 5-tert-Butylisophthalic acid (2359-09-3) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |


