A7907212
<i>trans</i>-4-Pentylcyclohexanecarboxylic Acid , >99.0%(GC)(T) , 38289-29-1
CAS NO.:38289-29-1
Empirical Formula: C12H22O2
Molecular Weight: 198.3
MDL number: MFCD00009964
EINECS: 626-251-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB32.80 | In Stock |
|
| 10g | RMB60.00 | In Stock |
|
| 25G | RMB91.20 | In Stock |
|
| 100g | RMB263.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51-53 °C (lit.) |
| Boiling point: | 295.63°C (rough estimate) |
| Density | 0.9590 (rough estimate) |
| refractive index | 1.4720 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 4.94±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C12H22O2/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h10-11H,2-9H2,1H3,(H,13,14)/t10-,11- |
| InChIKey | RVLAXPQGTRTHEV-XYPYZODXSA-N |
| SMILES | CCCCC[C@@H]1CC[C@H](CC1)C(O)=O |
| CAS DataBase Reference | 38289-29-1(CAS DataBase Reference) |
Description and Uses
trans-4-Pentylcyclohexanecarboxylic acid has been used in preparation of:
- 4-[(2-(trans-4-pentylcyclohexyl)ethyl]phenol
- 4-[(4-trans-pentyl-cyclohexanecarbonyl)-(4-pyridin-4-yl-benzyl)-amino]-piperidine-1-tert-butyl carbamate
- 2-cyano-1-benzofuran-5-yl trans-4-pentylcyclohexanecarboxylate
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29162090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |






