A7898112
<i>trans</i>-4-Propylcyclohexanecarboxylic Acid , >98.0%(GC) , 38289-27-9
CAS NO.：38289-27-9
Empirical Formula: C10H18O2
Molecular Weight: 170.25
MDL number: MFCD00059559
EINECS: 679-815-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB74.40 | In Stock |
|
| 100g | RMB186.40 | In Stock |
|
| 500g | RMB842.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93°C |
| Boiling point: | 270.3±8.0 °C(Predicted) |
| Density | 0.985±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.92±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C10H18O2/c1-2-3-8-4-6-9(7-5-8)10(11)12/h8-9H,2-7H2,1H3,(H,11,12)/t8-,9- |
| InChIKey | QCNUKEGGHOLBES-KYZUINATSA-N |
| SMILES | [C@@H]1(C(O)=O)CC[C@@H](CCC)CC1 |
| CAS DataBase Reference | 38289-27-9(CAS DataBase Reference) |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 26-36/37/39-60-37 |
| HS Code | 29162090 |
