BD5007441
trans-4-Methylcyclohexanecarboxylicacid , 98% , 13064-83-0
CAS NO.:13064-83-0
Empirical Formula: C8H14O2
Molecular Weight: 142.2
MDL number: MFCD00074943
EINECS: 235-959-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB27.20 | In Stock |
|
| 25g | RMB36.80 | In Stock |
|
| 100g | RMB144.80 | In Stock |
|
| 500g | RMB665.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 109-111 °C (lit.) |
| Boiling point: | 245 °C |
| Density | 1.025±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | pK1:4.89 (25°C) |
| color | White to Almost white |
| InChI | InChI=1S/C8H14O2/c1-6-2-4-7(5-3-6)8(9)10/h6-7H,2-5H2,1H3,(H,9,10)/t6-,7- |
| InChIKey | QTDXSEZXAPHVBI-LJGSYFOKSA-N |
| SMILES | [C@@H]1(C(O)=O)CC[C@@H](C)CC1 |
| CAS DataBase Reference | 13064-83-0(CAS DataBase Reference) |
Description and Uses
trans-4-Methyl-1-cyclohexanecarboxylic acid may be used in chemical synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29162090 |
| Storage Class | 11 - Combustible Solids |







