A3263812
2,5-Difluorocinnamic acid , 98% , 112898-33-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB46.40 | In Stock |
|
| 5G | RMB155.20 | In Stock |
|
| 25G | RMB696.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138-140 °C (lit.) |
| Boiling point: | 278.5±25.0 °C(Predicted) |
| Density | 1.3056 (estimate) |
| storage temp. | Store at room temperature |
| form | powder |
| pka | 4.16±0.10(Predicted) |
| color | Off-white |
| BRN | 7918450 |
| InChI | InChI=1S/C9H6F2O2/c10-7-2-3-8(11)6(5-7)1-4-9(12)13/h1-5H,(H,12,13)/b4-1+ |
| InChIKey | XAWHCSKPALFWBI-DAFODLJHSA-N |
| SMILES | C(O)(=O)/C=C/C1=CC(F)=CC=C1F |
| CAS DataBase Reference | 112898-33-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,5-Difluorocinnamic acid(112898-33-6) |
Description and Uses
trans-2,5-Difluorocinnamic acid may be used in chemical synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-26/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
