A7776512
trans-3,5-Difluorocinnamic Acid , 99% , 147700-58-1
CAS NO.:147700-58-1
Empirical Formula: C9 H6 F2 O2
Molecular Weight: 184.14
MDL number: MFCD00010321
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB239.20 | In Stock |
|
| 25g | RMB524.80 | In Stock |
|
| 100g | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-205 °C (lit.) |
| Boiling point: | 272.0±25.0 °C(Predicted) |
| Density | 1.379±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.15±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C9H6F2O2/c10-7-3-6(1-2-9(12)13)4-8(11)5-7/h1-5H,(H,12,13)/b2-1+ |
| InChIKey | MBAWRXICVNIUGY-OWOJBTEDSA-N |
| SMILES | C(O)(=O)/C=C/C1=CC(F)=CC(F)=C1 |
| CAS DataBase Reference | 147700-58-1(CAS DataBase Reference) |
Description and Uses
3,5-Difluorocinnamic acid has been used in the synthesis of “unnatural” flavonoids and stilbenes in Escherichia coli.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






