A7911612
Tetrabutylammonium Perrhenate , 98% , 16385-59-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB596.80 | In Stock |
|
| 5G | RMB1879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C, sealed storage, away from moisture |
| form | powder |
| color | White to Almost white |
| InChI | 1S/C16H36N.4O.Re/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;;;;/h5-16H2,1-4H3;;;;;/q+1;;;;-1; |
| InChIKey | MTTXKKTWRLXAKW-UHFFFAOYSA-N |
| SMILES | [O-][Re](=O)(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC |
| CAS DataBase Reference | 16385-59-4 |
Description and Uses
Starting material for rhenium complexes of o-phenylenediamine and o-aminobenzenethiol and for perrhenate salt formation with nickel porphyrins. Model compound for the synthesis of diagnostic radiopharmaceuticals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| F | 3 |
| HS Code | 2923.90.0100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





