A7692412
Tetrabutylammonium fluoride solution , 75%water solution , 429-41-4
Synonym(s):
‘Fluoride’ on silica gel;TBAF;TBAF on silica gel;TBAF solution
CAS NO.:429-41-4
Empirical Formula: C16H36FN
Molecular Weight: 261.46
MDL number: MFCD00149980
EINECS: 207-057-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB25.60 | In Stock |
|
| 25G | RMB63.20 | In Stock |
|
| 100G | RMB160.80 | In Stock |
|
| 500G | RMB648.80 | In Stock |
|
| 2.5kg | RMB2383.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-63 °C(lit.) |
| Density | 0.953 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 1 °F |
| storage temp. | 2-8°C |
| solubility | Miscible with terahydrofuran, acetonitrile, dimethyl sulfoxide and organic solvents. |
| form | Solution |
| color | Clear light greenish to brown |
| Water Solubility | Insoluble in water. |
| Sensitive | Hygroscopic |
| Merck | 14,9187 |
| BRN | 3570522 |
| Exposure limits | ACGIH: TWA 2.5 mg/m3 NIOSH: IDLH 250 mg/m3 |
| InChI | 1S/C16H36N.FH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | FPGGTKZVZWFYPV-UHFFFAOYSA-M |
| SMILES | [F-].CCCC[N+](CCCC)(CCCC)CCCC |
| CAS DataBase Reference | 429-41-4(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Butanaminium, N,N,N-tributyl-, fluoride (429-41-4) |
Description and Uses
Catalyst for etherification of alcohols and phenols with alkyl halides Catalyst for benzylation reactions.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H411 |
| Precautionary statements | P264-P270-P273-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,F,Xi |
| Risk Statements | 34-19-11-36/37/38-40-37 |
| Safety Statements | 26-27-36/37/39-45-33-29-16-36 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 3 |
| Hazard Note | Flammable/Irritant |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29239000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Irrit. 2 Repr. 2 Skin Irrit. 2 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





