A7912812
2,4,6-Trimethylstyrene (stabilized with TBC) , 95% , 769-25-5
CAS NO.:769-25-5
Empirical Formula: C11H14
Molecular Weight: 146.23
MDL number: MFCD00008613
EINECS: 212-205-4
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB208.80 | In Stock |
|
| 5ML | RMB701.60 | In Stock |
|
| 25ML | RMB2388.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -37°C |
| Boiling point: | 209 °C (lit.) |
| Density | 0.906 g/mL at 25 °C (lit.) |
| refractive index | 1.5320 |
| Flash point: | 75°C |
| storage temp. | 2-8°C |
| solubility | Soluble in methanol. |
| form | clear liquid |
| color | Colorless to Light yellow |
| BRN | 1904365 |
| InChI | InChI=1S/C11H14/c1-5-11-9(3)6-8(2)7-10(11)4/h5-7H,1H2,2-4H3 |
| InChIKey | PDELBHCVXBSVPJ-UHFFFAOYSA-N |
| SMILES | C1(C)=CC(C)=CC(C)=C1C=C |
| CAS DataBase Reference | 769-25-5(CAS DataBase Reference) |
Description and Uses
2,4,6-Trimethylstyrene is used as an intermediate to produce other chemicals like 2-Methoxy-1-(2, 4, 6-trimethyl-phenyl)-ethanone.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 23-36/37/39 |
| WGK Germany | 3 |
| HS Code | 2902.90.3050 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |






