A7915112
2,2,2-Trifluoro-4'-methoxyacetophenone , >98.0%(GC) , 711-38-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB212.40 | In Stock |
|
| 5G | RMB642.96 | In Stock |
|
| 10g | RMB1253.60 | In Stock |
|
| 25G | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 64°C/0.5mm |
| Density | 1.32 |
| refractive index | 1.4970 to 1.5020 |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Yellow |
| InChI | InChI=1S/C9H7F3O2/c1-14-7-4-2-6(3-5-7)8(13)9(10,11)12/h2-5H,1H3 |
| InChIKey | NCJZVRPXSSYDBG-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(OC)C=C1)C(F)(F)F |
| CAS DataBase Reference | 711-38-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P304+P340-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-24/25 |
| HS Code | 29147000 |
