A7916712
<i>trans</i>-Stilbene Oxide , >98.0%(HPLC) , 1439-07-2
Synonym(s):
trans-1,2-Diphenyloxirane
CAS NO.：1439-07-2
Empirical Formula: C14H12O
Molecular Weight: 196.24
MDL number: MFCD00064311
EINECS: 215-877-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB157.60 | In Stock |
|
| 5G | RMB374.40 | In Stock |
|
| 25G | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-67 °C(lit.) |
| Boiling point: | 273.14°C (rough estimate) |
| Density | 1.0405 (rough estimate) |
| refractive index | 1.4700 (estimate) |
| storage temp. | 2-8°C |
| solubility | soluble in Toluene |
| form | Crystals |
| color | White |
| BRN | 82740 |
| InChI | 1S/C14H12O/c1-3-7-11(8-4-1)13-14(15-13)12-9-5-2-6-10-12/h1-10,13-14H/t13-,14-/m1/s1 |
| InChIKey | ARCJQKUWGAZPFX-ZIAGYGMSSA-N |
| SMILES | O1[C@@H]([C@H]1c2ccccc2)c3ccccc3 |
| CAS DataBase Reference | 1439-07-2(CAS DataBase Reference) |
| EPA Substance Registry System | Oxirane, 2,3-diphenyl-, (2R,3R)-rel- (1439-07-2) |
Description and Uses
trans-Stilbene Oxide is used in preparation method of metal complex covalent organic framework material.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | F |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | DT4391500 |
| Hazard Note | Flammable |
| HS Code | 29109000 |
| Storage Class | 11 - Combustible Solids |
