A7919312
Tetrabutylammonium Tetrafluoroborate , ≥98.0% , 429-42-5
CAS NO.：429-42-5
Empirical Formula: C16H36BF4N
Molecular Weight: 329.27
MDL number: MFCD00011634
EINECS: 207-058-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB48.80 | In Stock |
|
| 100G | RMB113.60 | In Stock |
|
| 500G | RMB434.40 | In Stock |
|
| 2.5kg | RMB2116.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-161 °C(lit.) |
| Flash point: | >93℃ |
| storage temp. | −20°C |
| solubility | methanol: 0.1 g/mL, clear, colorless |
| form | Crystalline Powder |
| color | White |
| Water Solubility | Slightly soluble |
| Sensitive | Hygroscopic |
| BRN | 3577508 |
| InChI | InChI=1S/C16H36N.BF4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3,4)5/h5-16H2,1-4H3;/q+1;-1 |
| InChIKey | DWWRDPSMLREDKW-UHFFFAOYSA-M |
| SMILES | [N+](CCCC)(CCCC)(CCCC)CCCC.[B-](F)(F)(F)F |
| CAS DataBase Reference | 429-42-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetrabutylammonium tetrafluoroborate(429-42-5) |
| EPA Substance Registry System | 1-Butanaminium, N,N,N-tributyl-, tetrafluoroborate(1-) (429-42-5) |
Description and Uses
TBATFB has been used as an electrolyte to understand the paraffin graphite powder modified with sweet potato tissue (PCPET) electrode response.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi,T,Xn |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 26-36-37/39-39 |
| RIDADR | UN 1759 8/PG III |
| WGK Germany | 3 |
| Hazard Note | Irritant/Hygroscopic |
| TSCA | Yes |
| HazardClass | TOXIC, HYGROSCOPIC |
| PackingGroup | III |
| HS Code | 29239000 |
