A7920112
Tetrabutylammonium Tribromide , >98.0%(T) , 38932-80-8
Synonym(s):
TBABr3;Tetrabutylammonium bromide perbromide
CAS NO.：38932-80-8
Empirical Formula: C16H36Br3N-2
Molecular Weight: 482.18
MDL number: MFCD00012110
EINECS: 609-598-3
| Pack Size | Price | Stock | Quantity |
| 25G | RMB29.60 | In Stock |
|
| 100G | RMB48.80 | In Stock |
|
| 500G | RMB184.00 | In Stock |
|
| 2.5kg | RMB1614.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71-76 °C (lit.) |
| Density | 1.5469 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Acetone (Slightly), Chloroform (Slightly) |
| form | Crystalline Powder |
| color | Yellow |
| Water Solubility | insoluble |
| BRN | 3746114 |
| InChI | InChI=1S/C16H36N.Br3/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-3-2/h5-16H2,1-4H3;/q+1;-1 |
| InChIKey | KEWPQWXPEDFWRU-UHFFFAOYSA-N |
| SMILES | [N+](CCCC)(CCCC)(CCCC)CCCC.[Br-](Br)Br |
| CAS DataBase Reference | 38932-80-8(CAS DataBase Reference) |
Description and Uses
Tetrabutylammonium Tribromide is used in the synthesis of antimicrobial agents via chalcones. Also used in the synthesis of potent tubulin polymerization inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN3261 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29211990 |
