A7921112
<i>trans</i>-3-Hexenedioic Acid , >98.0%(T) , 4436-74-2
Synonym(s):
trans-3-Hexenedioic acid;2-Butene-1,4-dicarboxylic acid;Dihydromuconic acid
CAS NO.：4436-74-2
Empirical Formula: C6H8O4
Molecular Weight: 144.13
MDL number: MFCD00002785
EINECS: 224-648-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB125.60 | In Stock |
|
| 5G | RMB399.20 | In Stock |
|
| 25g | RMB1244.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195-196 °C(lit.) |
| Boiling point: | 368.7±22.0 °C(Predicted) |
| Density | 1.305±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.96±0.10(Predicted) |
| color | White to Off-White |
| BRN | 1723581 |
| InChI | 1S/C6H8O4/c7-5(8)3-1-2-4-6(9)10/h1-2H,3-4H2,(H,7,8)(H,9,10)/b2-1+ |
| InChIKey | YHGNXQAFNHCBTK-OWOJBTEDSA-N |
| SMILES | [H]\C(CC(O)=O)=C(\[H])CC(O)=O |
| CAS DataBase Reference | 4436-74-2(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Hexenedioic acid (4436-74-2) |
Description and Uses
trans-3-Hexenedioic Acid is used as a starting material in the synthesis of Adipic Acid (A291590) which is primarily used in the synthesis of nylon.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2917198090 |
| Storage Class | 11 - Combustible Solids |
