A7921512
3,3,3-Triphenylpropionic Acid , >98.0%(HPLC)(T) , 900-91-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB97.60 | In Stock |
|
| 25G | RMB380.80 | In Stock |
|
| 100G | RMB1327.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-182 °C (lit.) |
| Boiling point: | 433.6±14.0 °C(Predicted) |
| Density | 1.161±0.06 g/cm3(Predicted) |
| vapor density | 10.1 (vs air) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.25±0.10(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 2057448 |
| InChI | InChI=1S/C21H18O2/c22-20(23)16-21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15H,16H2,(H,22,23) |
| InChIKey | XMSJLUKCGWQAHO-UHFFFAOYSA-N |
| SMILES | C(CC(=O)O)(C1=CC=CC=C1)(C1C=CC=CC=1)C1C=CC=CC=1 |
| CAS DataBase Reference | 900-91-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,3,3-Triphenylpropionic acid(900-91-4) |
Description and Uses
3,3,3-Triphenylpropionic acid is used as pharmaceutical intermediates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
