A7926612
<i>trans</i>-2,4-Dichlorocinnamic Acid , >98.0%(T) , 20595-45-3
CAS NO.：20595-45-3
Empirical Formula: C9H6Cl2O2
Molecular Weight: 217.05
MDL number: MFCD00004373
EINECS: 639-402-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB70.40 | In Stock |
|
| 25G | RMB750.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 233-235 °C(lit.) |
| Boiling point: | 359.4±27.0 °C(Predicted) |
| Density | 1.457±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 4.17±0.13(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 1369152 |
| InChI | InChI=1S/C9H6Cl2O2/c10-7-3-1-6(8(11)5-7)2-4-9(12)13/h1-5H,(H,12,13)/b4-2+ |
| InChIKey | MEBWABJHRAYGFW-DUXPYHPUSA-N |
| SMILES | C(O)(=O)/C=C/C1=CC=C(Cl)C=C1Cl |
| CAS DataBase Reference | 20595-45-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37 |
| WGK Germany | 3 |
| RTECS | GD8575000 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
