A7383912
Sinapic acid , MALDI-MS matrix , 530-59-6
Synonym(s):
3,5-Dimethoxy-4-hydroxycinnamic acid;4-Hydroxy-3,5-dimethoxy-cinnamic acid;Sinapinic acid
CAS NO.:530-59-6
Empirical Formula: C11H12O5
Molecular Weight: 224.21
MDL number: MFCD00004401
EINECS: 208-487-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB399.20 | In Stock |
|
| 5G | RMB547.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~202 °C |
| Boiling point: | 285.61°C (rough estimate) |
| Density | 1.1478 (rough estimate) |
| refractive index | 1.4720 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | H2O: slightly soluble |
| pka | 4.53±0.10(Predicted) |
| form | powder |
| color | white |
| Odor | at 100.00?%. odorless |
| Water Solubility | insoluble |
| BRN | 2130006 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. Combustible. |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C11H12O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h3-6,14H,1-2H3,(H,12,13)/b4-3+ |
| InChIKey | PCMORTLOPMLEFB-ONEGZZNKSA-N |
| SMILES | COc1cc(\C=C\C(O)=O)cc(OC)c1O |
| LogP | 0.997 (est) |
| CAS DataBase Reference | 530-59-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Cinnamic acid, 4-hydroxy-3,5-dimethoxy-(530-59-6) |
Description and Uses
Sinapic acid was suitable as phenolic standard for HPLC analysis in determination of Sinapic acid derivatives in Canola extracts. 10 g/L of sinapinic acid with solvent was suitable as matrix for ultraviolet laser desorption mass spectrometric determination of proteins. It was also suitable to use as matrix for MALDI-TOFMS and MALDI-ion mobility-TOFMS to determine phospholipids in tissue.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







