A0844312
α-Cyano-4-hydroxycinnamic Acid , 98% , 28166-41-8
CAS NO.:28166-41-8
Empirical Formula: C10H7NO3
Molecular Weight: 189.17
MDL number: MFCD00004204
EINECS: 248-879-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB49.60 | In Stock |
|
| 5G | RMB176.00 | In Stock |
|
| 25G | RMB605.60 | In Stock |
|
| 100G | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 245-250 °C(lit.) |
| Boiling point: | 324.41°C (rough estimate) |
| Density | 1.3175 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| storage temp. | 2-8°C |
| solubility | methanol: 10 mg/mL, clear |
| form | powder |
| pka | 0.85±0.10(Predicted) |
| color | yellow |
| Water Solubility | H2O: slightly soluble methanol: water: soluble polar organic solvents: soluble |
| BRN | 3271427 |
| InChI | InChI=1S/C10H7NO3/c11-6-8(10(13)14)5-7-1-3-9(12)4-2-7/h1-5,12H,(H,13,14) |
| InChIKey | AFVLVVWMAFSXCK-VMPITWQZSA-N |
| SMILES | C(O)(=O)C(C#N)=CC1=CC=C(O)C=C1 |
| CAS DataBase Reference | 28166-41-8(CAS DataBase Reference) |
| Absorption | ≥2000 at 337nm (mol. absorption) |
Description and Uses
α-Cyano-4-hydroxycinnamic acid(CHC) was used as a matrix for peptides and nucleotides in mass spectroscopic analysis. It was used in encapsulation of CHC into NaY zeolite. It was used as matrix to investigate the activity of the paclitaxel derivatives using several well-established in vitro angiogenesis assays.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 29269090 |





![(E)-3-(benzo[d][1,3]dioxol-5-yl)-2-cyanoacrylicacid](https://img.chemicalbook.com/CAS/GIF/49711-55-9.gif)
