M7408658
Cinnamyl-3,4-dihydroxy-α-cyanocinnamate , ≥98% , 132465-11-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB3600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 583.9±50.0 °C(Predicted) |
| Density | 1.326±0.06 g/cm3(Predicted) |
| storage temp. | room temp |
| solubility | DMSO: ≥15mg/mL |
| form | powder |
| pka | 8.75±0.10(Predicted) |
| color | light yellow to yellow |
| InChI | 1S/C19H15NO4/c20-13-16(11-15-8-9-17(21)18(22)12-15)19(23)24-10-4-7-14-5-2-1-3-6-14/h1-9,11-12,21-22H,10H2/b7-4+,16-11+ |
| InChIKey | XGHYFEJMJXGPGN-UYHGDYIZSA-N |
| SMILES | Oc1ccc(cc1O)\C=C(/C#N)C(=O)OC\C=C\c2ccccc2 |
Description and Uses
CDC is an inhibitor of 5-LO, 12-LO, and 15-LO.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H410 |
| Precautionary statements | P261-P272-P273-P280-P302+P352-P333+P313 |
| Hazard Codes | Xi,N |
| Risk Statements | 43-50/53 |
| Safety Statements | 36/37-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HazardClass | 9 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |








