A7929212
2,2,2-Trifluoroethyl Nonafluorobutanesulfonate , >96.0%(GC) , 79963-95-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB103.20 | In Stock |
|
| 5G | RMB375.20 | In Stock |
|
| 25G | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 138-140 |
| Density | 1.636 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 160 °F |
| storage temp. | Store at room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | clear liquid |
| color | Colorless to Light yellow |
| Stability: | Hygroscopic, Unstable in Solution |
| InChI | 1S/C6H2F12O3S/c7-2(8,9)1-21-22(19,20)6(17,18)4(12,13)3(10,11)5(14,15)16/h1H2 |
| InChIKey | KJGYBFLEIPDFNQ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)COS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 79963-95-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2,2,2-Trifluoroethyl perfluorobutanesulfonate (79963-95-4) |
Description and Uses
2,2,2-Trifluoroethyl perfluorobutylsulfonate may be used in the synthesis of 1,2,3,4-tetrahydro-1,1,4,4-tetramethyl-6,7-bis(2,2,2-trifluoro-ethoxy)-naphthalene (TTBN).
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,T |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Corrosive |
| HazardClass | TOXIC, CORROSIVE |
| HS Code | 2905599890 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |






