A7930512
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1<i>H</i>-indole , >97.0%(HPLC) , 269410-24-4
Synonym(s):
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB66.40 | In Stock |
|
| 1G | RMB151.20 | In Stock |
|
| 5G | RMB378.40 | In Stock |
|
| 25g | RMB1300.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-125 °C (lit.) |
| Boiling point: | 396.0±15.0 °C(Predicted) |
| Density | 1.11±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| pka | 17.01±0.30(Predicted) |
| color | Pale yellow to brown |
| Water Solubility | Insoluble |
| InChI | 1S/C14H18BNO2/c1-13(2)14(3,4)18-15(17-13)11-5-6-12-10(9-11)7-8-16-12/h5-9,16H,1-4H3 |
| InChIKey | FATPQDPUKVVCLT-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(OC1(C)C)c2ccc3[nH]ccc3c2 |
| CAS DataBase Reference | 269410-24-4(CAS DataBase Reference) |
Description and Uses
Indole-5-boronic acid, pinacol ester
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
