A7931812
2,4,6-Tri-<i>tert</i>-butylaniline , >98.0%(GC) , 961-38-6
CAS NO.：961-38-6
Empirical Formula: C18H31N
Molecular Weight: 261.45
MDL number: MFCD00011645
EINECS: 213-507-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB86.40 | In Stock |
|
| 5G | RMB317.60 | In Stock |
|
| 10g | RMB608.00 | In Stock |
|
| 25G | RMB1399.20 | In Stock |
|
| 100G | RMB3839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-147 °C(lit.) |
| Boiling point: | 302.0±21.0 °C(Predicted) |
| Density | 0.896±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 3.30±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | Insoluble in water. |
| Sensitive | Light Sensitive |
| BRN | 2272612 |
| InChI | InChI=1S/C18H31N/c1-16(2,3)12-10-13(17(4,5)6)15(19)14(11-12)18(7,8)9/h10-11H,19H2,1-9H3 |
| InChIKey | REJGDSCBQPJPQT-UHFFFAOYSA-N |
| SMILES | C1(N)=C(C(C)(C)C)C=C(C(C)(C)C)C=C1C(C)(C)C |
| CAS DataBase Reference | 961-38-6(CAS DataBase Reference) |
Description and Uses
2,4,6-Tri-tert-butylnitrobenzene (bulky amine) was used in the synthesis of monomeric iminophosphorane.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2921490090 |
