A7931912
Tris(2-ethylhexyl)amine , >93.0%(GC) , 1860-26-0
CAS NO.：1860-26-0
Empirical Formula: C24H51N
Molecular Weight: 353.67
MDL number: MFCD00042903
EINECS: 217-461-0
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB31.20 | In Stock |
|
| 25ML | RMB61.60 | In Stock |
|
| 100ML | RMB157.60 | In Stock |
|
| 500ML | RMB515.20 | In Stock |
|
| 2.5L | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 120-125 °C(Press: 0.1 Torr) |
| Density | 0.817 g/mL at 20 °C(lit.) |
| vapor pressure | 0.001Pa at 20℃ |
| refractive index | n |
| Flash point: | 163°C |
| form | clear liquid |
| pka | 9.32±0.50(Predicted) |
| color | Colorless to Light orange to Yellow |
| BRN | 2087270 |
| InChI | InChI=1S/C24H51N/c1-7-13-16-22(10-4)19-25(20-23(11-5)17-14-8-2)21-24(12-6)18-15-9-3/h22-24H,7-21H2,1-6H3 |
| InChIKey | BZUDVELGTZDOIG-UHFFFAOYSA-N |
| SMILES | C(N(CC(CC)CCCC)CC(CC)CCCC)C(CC)CCCC |
| LogP | 10.13 at 25℃ |
| CAS DataBase Reference | 1860-26-0(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Hexanamine, 2-ethyl-N,N-bis(2-ethylhexyl)- (1860-26-0) |
Description and Uses
Tris(2-ethylhexyl)amine is a compound used in the extraction and stripping of inorganic acids.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H360F-H373 |
| Precautionary statements | P260-P314-P501 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50/53 |
| Safety Statements | 26-36-61 |
| RIDADR | UN 2735 8/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2921.19.6190 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B STOT RE 2 |
